On Target NP_HCoV-OC43 0.049295776/CHEMBL3233481
For the given ligand Beclomethasone dipropionate, we have found in our database that, being scored 0.049295776, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| Beclomethasone dipropionate (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| CCC(=O)OCC(=O)[C@@]4(OC(=O)CC)[C@@H](C)C[C@H]3[C@@H]2CC/C1=C/C(=O)/C=C\C1(C)[C@@]2(Cl)[C@@H](O)C[C@@]34C | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 000b0042 81000000 00000100 00090300 00380040 00000000 00000080 02000402 01000000 01100000 00000400 4000d000 04028028 00800000 00000400 08081008 00820000 80002000 13412000 00022001 00000021 90000b80 01008000 00000814 00200400 08000000 00404000 80000008 00800200 0100000a 24020000 02822800 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |