On Target PLP_SARS 0.23837209/CHEMBL213543
For the given ligand Beclomethasone dipropionate, we have found in our database that, being scored 0.23837209, the most similar ligand is CHEMBL213543. Check out the elaboration below.
| Beclomethasone dipropionate (Given Ligand) | CHEMBL213543 (Similar Ligand) |
|---|---|
| CCC(=O)OCC(=O)[C@@]4(OC(=O)CC)[C@@H](C)C[C@H]3[C@@H]2CC/C1=C/C(=O)/C=C\C1(C)[C@@]2(Cl)[C@@H](O)C[C@@]34C | CCOC(=O)/C=C/[C@H](C[C@@H]1CCNC1=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)OCc1ccccc1)C(C)C |
|
|
|
|
|
|
| 000b0042 81000000 00000100 00090300 00380040 00000000 00000080 02000402 01000000 01100000 00000400 4000d000 04028028 00800000 00000400 08081008 00820000 80002000 13412000 00022001 00000021 90000b80 01008000 00000814 00200400 08000000 00404000 80000008 00800200 0100000a 24020000 02822800 | 01030000 0140b000 00100100 04010600 00000000 0001c810 02100080 28000408 01a00300 001088c0 40200000 4003b000 0e028002 00012001 80000400 021a0008 20020000 02080500 20012890 00001201 00002000 38040fb0 00008003 02500018 00001400 8800ac02 00484000 90200120 08000200 00060001 ec004000 02802210 |