On Target NS3_HCV1B 0.29032257/CHEMBL3954962
For the given ligand Ketorolac, we have found in our database that, being scored 0.29032257, the most similar ligand is CHEMBL3954962. Check out the elaboration below.
| Ketorolac (Given Ligand) | CHEMBL3954962 (Similar Ligand) |
|---|---|
| O=C(O)C2CCn3c(C(=O)c1ccccc1)ccc23 | C=CC(=O)NC[C@H](NC(=O)[C@@H](NC(=O)c1cnccn1)C1CCCCC1)C(=O)N1C[C@@H]2CCC[C@@H]2[C@H]1C(=O)N[C@@H](CCC)C(OC(=O)C(F)(F)F)C(=O)NC1CC1 |
|
|
|
|
|
|
| 0002000a 00005a00 00101100 50010600 001000e0 00080000 00000000 21101100 00100900 100808c0 08188024 40819800 07008000 00100000 c00e0400 000c008c 18008000 06000085 08600008 00000001 00000100 18068a10 29802000 0054041c 00000000 e0000080 08000010 50001000 00080084 0086004b a0007280 20000400 | 10018002 01807400 00100b00 94010f10 000800c0 00100010 0000c00c 20003409 11000000 000101a0 01290000 4001f000 0e00801a 01112001 809a1408 000c110c 18860000 82000103 02402010 00001205 80000120 300f8e30 33004003 0250001c 00141400 00000000 08880000 90000005 08000204 01060813 a4024000 82002600 |