On Target PR_HIV1 0.22222222/CHEMBL492666
For the given ligand Ketorolac, we have found in our database that, being scored 0.22222222, the most similar ligand is CHEMBL492666. Check out the elaboration below.
| Ketorolac (Given Ligand) | CHEMBL492666 (Similar Ligand) |
|---|---|
| O=C(O)C2CCn3c(C(=O)c1ccccc1)ccc23 | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2CCCCCC2)cc1 |
|
|
|
|
|
|
| 0002000a 00005a00 00101100 50010600 001000e0 00080000 00000000 21101100 00100900 100808c0 08188024 40819800 07008000 00100000 c00e0400 000c008c 18008000 06000085 08600008 00000001 00000100 18068a10 29802000 0054041c 00000000 e0000080 08000010 50001000 00080084 0086004b a0007280 20000400 | 00000010 01c05408 2110010a 01b10700 00081080 00028000 02000000 a0000004 00540a00 004809e0 08302000 60018000 00008002 00a00101 81e80001 001a0008 10822000 02080000 00402800 01027603 80000100 18280c90 03100040 d9500058 02000000 8000100e 00800000 1020108c 04000600 20060013 80020000 00012670 |