On Target NS5B_HCV1A 0.3539823/CHEMBL353549
For the given ligand Ketorolac, we have found in our database that, being scored 0.3539823, the most similar ligand is CHEMBL353549. Check out the elaboration below.
| Ketorolac (Given Ligand) | CHEMBL353549 (Similar Ligand) |
|---|---|
| O=C(O)C2CCn3c(C(=O)c1ccccc1)ccc23 | O=C(N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)c1ccc2c(c1)nc(-c1ccoc1)n2C1CCCCC1 |
|
|
|
|
|
|
| 0002000a 00005a00 00101100 50010600 001000e0 00080000 00000000 21101100 00100900 100808c0 08188024 40819800 07008000 00100000 c00e0400 000c008c 18008000 06000085 08600008 00000001 00000100 18068a10 29802000 0054041c 00000000 e0000080 08000010 50001000 00080084 0086004b a0007280 20000400 | 0000800a 0120f890 00180100 51850612 200c10e1 00006000 00002000 0220100c 00424980 900918c0 0d30800c 4001b000 5e009c02 00c08800 000204c0 028c000c 10000008 02002004 02e02408 00400201 c0120100 38268e38 23800041 9158001c 00047801 c0004000 08400050 98800000 04400104 04460c43 e00cca00 000006a0 |