On Target NSP15_SARS 0.28961748/CHEMBL2441741
For the given ligand Ketorolac, we have found in our database that, being scored 0.28961748, the most similar ligand is CHEMBL2441741. Check out the elaboration below.
| Ketorolac (Given Ligand) | CHEMBL2441741 (Similar Ligand) |
|---|---|
| O=C(O)C2CCn3c(C(=O)c1ccccc1)ccc23 | CC(C)C[C@H](NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCc1ccccc1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 0002000a 00005a00 00101100 50010600 001000e0 00080000 00000000 21101100 00100900 100808c0 08188024 40819800 07008000 00100000 c00e0400 000c008c 18008000 06000085 08600008 00000001 00000100 18068a10 29802000 0054041c 00000000 e0000080 08000010 50001000 00080084 0086004b a0007280 20000400 | 01030000 01403200 00100100 04010600 00000000 0001c010 00000000 2000000c 00e00b00 000a08c0 08300000 4003b000 0e00801a 00012001 80000000 021e0008 00020000 02080400 00002898 00000201 00000100 38240e38 00000003 83500018 00000800 80002002 00000000 10200020 0c000200 0006000b e0004000 00802600 |