On Target PLP_SARS 0.34104046/CHEMBL358279
For the given ligand Ketorolac, we have found in our database that, being scored 0.34104046, the most similar ligand is CHEMBL358279. Check out the elaboration below.
| Ketorolac (Given Ligand) | CHEMBL358279 (Similar Ligand) |
|---|---|
| O=C(O)C2CCn3c(C(=O)c1ccccc1)ccc23 | NC(=O)c1ccc2c(c1)C(=O)C(=O)N2Cc1ccc2ccccc2c1 |
|
|
|
|
|
|
| 0002000a 00005a00 00101100 50010600 001000e0 00080000 00000000 21101100 00100900 100808c0 08188024 40819800 07008000 00100000 c00e0400 000c008c 18008000 06000085 08600008 00000001 00000100 18068a10 29802000 0054041c 00000000 e0000080 08000010 50001000 00080084 0086004b a0007280 20000400 | 1000c002 00800800 00100100 80010600 20001001 00010040 00800000 02081000 04800080 00080e40 08280004 4000f000 03008802 00108000 40020540 08080008 00048000 02000000 08000400 00000200 c0100400 18228608 20012000 8144001d 00000000 c0000280 08000010 80005080 04088100 00060003 a0047000 20000600 |