On Target NS3_HCV1B 0.20418848/CHEMBL3954962
For the given ligand Hydroxychloroquine, we have found in our database that, being scored 0.20418848, the most similar ligand is CHEMBL3954962. Check out the elaboration below.
| Hydroxychloroquine (Given Ligand) | CHEMBL3954962 (Similar Ligand) |
|---|---|
| CCN(CCO)CCCC(C)Nc1ccnc2cc(Cl)ccc12 | C=CC(=O)NC[C@H](NC(=O)[C@@H](NC(=O)c1cnccn1)C1CCCCC1)C(=O)N1C[C@@H]2CCC[C@@H]2[C@H]1C(=O)N[C@@H](CCC)C(OC(=O)C(F)(F)F)C(=O)NC1CC1 |
|
|
|
|
|
|
| 0001c002 01000000 00104000 00000600 200c0080 00002000 08008000 20000000 00200000 000008c0 00200004 40038800 02000806 00400000 000a0040 000c000c 10040000 00000000 08200000 00000201 40100000 18048108 22800000 80100010 00006000 00000000 00008000 10000080 00008000 00060000 00040000 00420240 | 10018002 01807400 00100b00 94010f10 000800c0 00100010 0000c00c 20003409 11000000 000101a0 01290000 4001f000 0e00801a 01112001 809a1408 000c110c 18860000 82000103 02402010 00001205 80000120 300f8e30 33004003 0250001c 00141400 00000000 08880000 90000005 08000204 01060813 a4024000 82002600 |