On Target NS3_HCV1B 0.5/CHEMBL3954962
For the given ligand Saquinavir, we have found in our database that, being scored 0.5, the most similar ligand is CHEMBL3954962. Check out the elaboration below.
| Saquinavir (Given Ligand) | CHEMBL3954962 (Similar Ligand) |
|---|---|
| CC(C)(C)NC(=O)[C@@H]2C[C@@H]1CCCC[C@@H]1CN2C[C@@H](O)[C@H](Cc3ccccc3)NC(=O)[C@H](CC(N)=O)NC(=O)c5ccc4ccccc4n5 | C=CC(=O)NC[C@H](NC(=O)[C@@H](NC(=O)c1cnccn1)C1CCCCC1)C(=O)N1C[C@@H]2CCC[C@@H]2[C@H]1C(=O)N[C@@H](CCC)C(OC(=O)C(F)(F)F)C(=O)NC1CC1 |
|
|
|
|
|
|
| 00038002 01007c00 00104102 14010e00 000400a0 00100000 00000000 2200300d 00300880 000909e0 08390004 5003b000 0e00880a 00702002 801a0440 020c010c 10000000 02000003 02602010 00000201 40000100 382b8618 23802041 8350001c 00101000 c0000000 00000040 90000000 0c000106 00060013 a0064000 00806600 | 10018002 01807400 00100b00 94010f10 000800c0 00100010 0000c00c 20003409 11000000 000101a0 01290000 4001f000 0e00801a 01112001 809a1408 000c110c 18860000 82000103 02402010 00001205 80000120 300f8e30 33004003 0250001c 00141400 00000000 08880000 90000005 08000204 01060813 a4024000 82002600 |