On Target PR_HIV1 0.2862069/CHEMBL492666
For the given ligand Paritaprevir, we have found in our database that, being scored 0.2862069, the most similar ligand is CHEMBL492666. Check out the elaboration below.
| Paritaprevir (Given Ligand) | CHEMBL492666 (Similar Ligand) |
|---|---|
| Cc8cnc(C(=O)N[C@H]7CCCCC/C=C\[C@@H]1C[C@@]1(C(=O)NS(=O)(=O)C2CC2)NC(=O)[C@@H]6C[C@@H](Oc4nc3ccccc3c5ccccc45)CN6C7=O)cn8 | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2CCCCCC2)cc1 |
|
|
|
|
|
|
| 1405a082 0d807018 20104908 15310f12 841410c0 02118110 060ac000 2000340b 10010200 005188d8 012d2404 4101b000 0682c81a 09542003 b1da15c1 001ca10c 1a224000 02000142 40e12000 02024201 c0020040 bc178e38 33a0c083 b2140138 02340001 00000000 08c04200 9000000d 0c000204 80060c81 a4064000 85012a70 | 00000010 01c05408 2110010a 01b10700 00081080 00028000 02000000 a0000004 00540a00 004809e0 08302000 60018000 00008002 00a00101 81e80001 001a0008 10822000 02080000 00402800 01027603 80000100 18280c90 03100040 d9500058 02000000 8000100e 00800000 1020108c 04000600 20060013 80020000 00012670 |