On Target NS5B_HCV1A 0.4876325/CHEMBL3644934
For the given ligand Paritaprevir, we have found in our database that, being scored 0.4876325, the most similar ligand is CHEMBL3644934. Check out the elaboration below.
| Paritaprevir (Given Ligand) | CHEMBL3644934 (Similar Ligand) |
|---|---|
| Cc8cnc(C(=O)N[C@H]7CCCCC/C=C\[C@@H]1C[C@@]1(C(=O)NS(=O)(=O)C2CC2)NC(=O)[C@@H]6C[C@@H](Oc4nc3ccccc3c5ccccc45)CN6C7=O)cn8 | CC(C)(C)OC(=O)N[C@H]1CCCCC/C=C\[C@@H]2C[C@@]2(C(=O)NS(=O)(=O)C2CC2)NC(=O)[C@@H]2CN(c3ccc(-c4ccccc4)cc3)CN2C1=O |
|
|
|
|
|
|
| 1405a082 0d807018 20104908 15310f12 841410c0 02118110 060ac000 2000340b 10010200 005188d8 012d2404 4101b000 0682c81a 09542003 b1da15c1 001ca10c 1a224000 02000142 40e12000 02024201 c0020040 bc178e38 33a0c083 b2140138 02340001 00000000 08c04200 9000000d 0c000204 80060c81 a4064000 85012a70 | 00016086 0d403c00 00100120 05310e00 20000000 00018000 000a0004 2000340b 10800200 00528be8 00202404 5101b000 0e02f00a 0104a001 80420440 001a8008 02064010 02482040 4c212850 02004a01 60100100 bc070e50 30028003 3254003a 02312000 80000002 00404000 902000ec 0c00c200 80060491 a41a4000 01016270 |