On Target NS5B_HCV1A 0.3611111/CHEMBL3644880
For the given ligand Bictegravir, we have found in our database that, being scored 0.3611111, the most similar ligand is CHEMBL3644880. Check out the elaboration below.
| Bictegravir (Given Ligand) | CHEMBL3644880 (Similar Ligand) |
|---|---|
| O=C(NCc1c(F)cc(F)cc1F)c5cn4C[C@H]3O[C@@H]2CC[C@@H](C2)N3C(=O)c4c(O)c5=O | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1CN(C(=O)c2ccccc2)CN1C(=O)[C@@H](NC(=O)OC1CCCC1)C(C)(C)C)C(=O)NS(=O)(=O)C1CC1 |
|
|
|
|
|
|
| 10000082 45c0fc08 60104100 d2010f90 041c102a 08128154 1c024000 a2203401 02200301 805308d0 01290004 c0018000 80009806 08581100 00021c80 221e710c 02a26200 82084106 00e00802 00160201 c0000021 383f8e50 23802081 6654013c 18152401 c0001082 08e00260 90240011 08440304 45068051 e40c0000 c0004a00 | 00010080 0d403c00 00100100 05310f00 00080000 00018000 000a0004 a2003408 10800200 005389e8 01202400 4001b000 0e00f802 01042101 80400400 001a8008 02824010 02082001 40610850 00004201 00000100 bc0f8e10 01000003 3244003c 02013000 c0001002 00000000 9020002c 08000300 81060293 a41c4000 81012270 |