On Target NS5B_HCV1A 0.53216374/CHEMBL13256
For the given ligand Saquinavir, we have found in our database that, being scored 0.53216374, the most similar ligand is CHEMBL13256. Check out the elaboration below.
| Saquinavir (Given Ligand) | CHEMBL13256 (Similar Ligand) |
|---|---|
| CC(C)(C)NC(=O)[C@@H]2C[C@@H]1CCCC[C@@H]1CN2C[C@@H](O)[C@H](Cc3ccccc3)NC(=O)[C@H](CC(N)=O)NC(=O)c5ccc4ccccc4n5 | CC[C@H](NC(=O)[C@H](CC1CCCCC1)NC(=O)[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)c1cnccn1)[C@@H](C)CC)C(=O)C(=O)NCC(=O)O |
|
|
|
|
|
|
| 00038002 01007c00 00104102 14010e00 000400a0 00100000 00000000 2200300d 00300880 000909e0 08390004 5003b000 0e00880a 00702002 801a0440 020c010c 10000000 02000003 02602010 00000201 40000100 382b8618 23802041 8350001c 00101000 c0000000 00000040 90000000 0c000106 00060013 a0064000 00806600 | 10018002 01807400 00100800 14000c10 000000c0 00100000 0000c000 20003009 14000000 000101a0 01292000 40013000 0e00800a 00102003 808a0400 000c010c 18020000 02000003 02002010 00000201 80000000 300f8e10 23004003 02100018 00141000 00000000 08000000 90000004 08000004 00060811 a0024000 80002200 |