On Target PLP_SARS 0.3183391/CHEMBL212080
For the given ligand Paritaprevir, we have found in our database that, being scored 0.3183391, the most similar ligand is CHEMBL212080. Check out the elaboration below.
| Paritaprevir (Given Ligand) | CHEMBL212080 (Similar Ligand) |
|---|---|
| Cc8cnc(C(=O)N[C@H]7CCCCC/C=C\[C@@H]1C[C@@]1(C(=O)NS(=O)(=O)C2CC2)NC(=O)[C@@H]6C[C@@H](Oc4nc3ccccc3c5ccccc45)CN6C7=O)cn8 | CCOC(=O)/C=C/[C@H](C[C@@H]1CCNC1=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)OCc1ccccc1)C(C)OC(C)(C)C |
|
|
|
|
|
|
| 1405a082 0d807018 20104908 15310f12 841410c0 02118110 060ac000 2000340b 10010200 005188d8 012d2404 4101b000 0682c81a 09542003 b1da15c1 001ca10c 1a224000 02000142 40e12000 02024201 c0020040 bc178e38 33a0c083 b2140138 02340001 00000000 08c04200 9000000d 0c000204 80060c81 a4064000 85012a70 | 01030000 0140f000 00100100 84010600 00040080 0023c810 02100080 28000408 01a00300 001088c0 40200000 4003b000 1e028002 00092001 80001408 021a0008 20220000 02080500 20812890 01001201 00002020 38040fb0 13008083 02500018 00001401 8800ac02 00c84800 90200120 08000200 00060001 ec004000 02802210 |