On Target NP_HCoV-OC43 0.0875/CHEMBL3233481
For the given ligand Oseltamivir, we have found in our database that, being scored 0.0875, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| Oseltamivir (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| CCOC(=O)/C1=C/C(OC(CC)CC)C(NC(C)=O)C(N)C1 | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 00070040 09007000 00100000 80010700 00180080 00000800 02080180 38000402 11000000 00100088 40200000 41019001 0402801a 01880000 00001408 00081008 10a24000 00000060 60c12010 00000201 00000020 30040e80 13008000 02100018 10001400 00001400 00c04200 90000001 0c000200 00040401 04020000 00000210 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |