On Target NSP1_SARS 0.24285714/CHEMBL2441745
For the given ligand Bictegravir, we have found in our database that, being scored 0.24285714, the most similar ligand is CHEMBL2441745. Check out the elaboration below.
| Bictegravir (Given Ligand) | CHEMBL2441745 (Similar Ligand) |
|---|---|
| O=C(NCc1c(F)cc(F)cc1F)c5cn4C[C@H]3O[C@@H]2CC[C@@H](C2)N3C(=O)c4c(O)c5=O | CC(C)C[C@H](NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCc1ccccc1)C(=O)N[C@@H](C[C@@H]1CCNC1=O)C(=O)C(=O)NC(C)C |
|
|
|
|
|
|
| 10000082 45c0fc08 60104100 d2010f90 041c102a 08128154 1c024000 a2203401 02200301 805308d0 01290004 c0018000 80009806 08581100 00021c80 221e710c 02a26200 82084106 00e00802 00160201 c0000021 383f8e50 23802081 6654013c 18152401 c0001082 08e00260 90240011 08440304 45068051 e40c0000 c0004a00 | 01030000 01403600 00100100 04010600 00000000 0001c010 00000000 2000000c 04e00b00 000a09e0 08300000 4003b000 0e00801a 00012001 80000000 021e0008 00020000 02080401 00002898 00000201 00000100 382c0e38 00000003 83500018 00001800 80002002 00000000 10200020 0c000200 0006001b e0024000 00802600 |