On Target RT_HIV1 0.30945557/CHEMBL4109767
For the given ligand Bictegravir, we have found in our database that, being scored 0.30945557, the most similar ligand is CHEMBL4109767. Check out the elaboration below.
| Bictegravir (Given Ligand) | CHEMBL4109767 (Similar Ligand) |
|---|---|
| O=C(NCc1c(F)cc(F)cc1F)c5cn4C[C@H]3O[C@@H]2CC[C@@H](C2)N3C(=O)c4c(O)c5=O | COC(=O)N[C@H](C(=O)NCc1ccc([C@@H](CO)N(Cc2cc3cccnc3[nH]2)S(=O)(=O)c2ccc(N)cc2)s1)C(c1ccccc1)c1ccccc1 |
|
|
|
|
|
|
| 10000082 45c0fc08 60104100 d2010f90 041c102a 08128154 1c024000 a2203401 02200301 805308d0 01290004 c0018000 80009806 08581100 00021c80 221e710c 02a26200 82084106 00e00802 00160201 c0000021 383f8e50 23802081 6654013c 18152401 c0001082 08e00260 90240011 08440304 45068051 e40c0000 c0004a00 | 0001001a 0080b200 03184100 15b10e01 100c00f0 0013c000 04000081 2b00700f 00c60b00 004938c0 09b12204 e000b880 8c008812 00d02021 b0262440 021e030c 18423000 0219000e 82700018 0000620d c0001900 78288eb0 23900000 cb400158 42100800 e4010406 40300800 d000206c 0c600784 2046000f e0044200 00c147e0 |