On Target NS3_HCV1A 0.34972677/CHEMBL3645675
For the given ligand Glimepiride, we have found in our database that, being scored 0.34972677, the most similar ligand is CHEMBL3645675. Check out the elaboration below.
| Glimepiride (Given Ligand) | CHEMBL3645675 (Similar Ligand) |
|---|---|
| CC/C3=C(C)/CN(C(=O)NCCc2ccc(S(=O)(=O)NC(=O)N[C@@H]1CC[C@@H](C)CC1)cc2)C3=O | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1C[C@@]2(CN1C(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H]1CCCN1CC)c1ccccc1)C(C)(C)C)C(C)(C)C21CCC1)C(=O)NS(=O)(=O)N1CCCC1 |
|
|
|
|
|
|
| 00000010 01809000 01100100 02b10e00 00000048 08000000 08000004 20003404 01000000 011828c0 08202000 e0019400 04009102 00010041 80200000 00000000 22002008 02000500 02412040 00006201 80022100 18250710 00008000 89500018 00010000 88000000 80400000 1000052c 04000400 20060003 0c0a0000 00012660 | 000100a0 09803000 06100100 05210600 00000000 00000010 000a0000 22001408 10000080 0019c9c8 08602000 4001b000 0701881a 01002011 e0400400 00000000 04004000 02000000 44012000 00004201 80000000 38248630 00000003 b3d00038 00000000 c0000000 00000000 90000010 0c000100 c0060083 64066004 00012660 |