On Target NS3_HCV1A 0.3/CHEMBL4106826
For the given ligand Canagliflozin, we have found in our database that, being scored 0.3, the most similar ligand is CHEMBL4106826. Check out the elaboration below.
| Canagliflozin (Given Ligand) | CHEMBL4106826 (Similar Ligand) |
|---|---|
| Cc2ccc([C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)cc2Cc4ccc(c3ccc(F)cc3)s4 | CC[C@@H](N)c1ccc(Cl)c(C(=O)c2ccc(COC(C)=O)cc2)c1F |
|
|
|
|
|
|
| 00012000 01800000 80100102 02050300 80a80051 10024010 00040480 0d102009 00000900 01480841 28100200 c0008a80 00000010 02a11000 00042000 020a9008 08020800 0200400a 15502000 50100005 00000920 680900a0 35004040 08400010 02000400 a4002000 00080800 40800265 020043ca 00068002 40020004 02c30600 | 00008040 00000800 00100100 42050600 00000211 00004010 20000000 01001000 00000900 00080e40 08100000 40008a00 02008864 00011004 00000000 0a080008 03020200 03000000 00000400 00000001 00000500 18028b20 01000000 10400014 00002400 a0002200 080c0000 40800081 00000280 00068002 c4040000 00020600 |