On Target PLP_SARS 0.32085562/CHEMBL213543
For the given ligand Glimepiride, we have found in our database that, being scored 0.32085562, the most similar ligand is CHEMBL213543. Check out the elaboration below.
| Glimepiride (Given Ligand) | CHEMBL213543 (Similar Ligand) |
|---|---|
| CC/C3=C(C)/CN(C(=O)NCCc2ccc(S(=O)(=O)NC(=O)N[C@@H]1CC[C@@H](C)CC1)cc2)C3=O | CCOC(=O)/C=C/[C@H](C[C@@H]1CCNC1=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)OCc1ccccc1)C(C)C |
|
|
|
|
|
|
| 00000010 01809000 01100100 02b10e00 00000048 08000000 08000004 20003404 01000000 011828c0 08202000 e0019400 04009102 00010041 80200000 00000000 22002008 02000500 02412040 00006201 80022100 18250710 00008000 89500018 00010000 88000000 80400000 1000052c 04000400 20060003 0c0a0000 00012660 | 01030000 0140b000 00100100 04010600 00000000 0001c810 02100080 28000408 01a00300 001088c0 40200000 4003b000 0e028002 00012001 80000400 021a0008 20020000 02080500 20012890 00001201 00002000 38040fb0 00008003 02500018 00001400 8800ac02 00484000 90200120 08000200 00060001 ec004000 02802210 |