On Target EDNRA_HUMAN 0.2962963/CHEMBL273948
For the given ligand yong1, we have found in our database that, being scored 0.2962963, the most similar ligand is CHEMBL273948. Check out the elaboration below.
| yong1 (Given Ligand) | CHEMBL273948 (Similar Ligand) |
|---|---|
| [H][C@@]12/C(CO)=C\[C@H](OC)[C@]1([H])/C(C(=O)OC)=C\O[C@H]2OC3OC(CO)C(O)C(O)C3O | COc1ccc(cc1)C2(O)OC(=O)C(=C2CC3CCCCC3)c4ccc5OCOc5c4 |
|
|
|
|
|
|
| 00050040 81000000 00000801 90010101 80290041 00000801 00022880 28011402 01200000 015080e8 48000200 40419011 8402802a 02800000 02000405 012a9008 00820004 00000100 1145e010 00008a01 00100020 00001a90 0500a000 08100010 00201420 80201400 00405002 a4000020 00004240 00000000 1ea0a000 00000010 | 00000040 43000008 2000030a 00810b00 00181151 00804800 82040881 08000440 01200900 00b80860 48100000 40109000 0502c002 20a10000 41040403 02289008 08820430 02100000 26492018 00020a01 00050320 08000aa0 01008021 00400010 41001400 84007400 005a6000 e0010420 01400202 00020102 64022000 02810510 |