On Target V1AR_HUMAN 0.27522936/CHEMBL251771
For the given ligand yong1, we have found in our database that, being scored 0.27522936, the most similar ligand is CHEMBL251771. Check out the elaboration below.
| yong1 (Given Ligand) | CHEMBL251771 (Similar Ligand) |
|---|---|
| [H][C@@]12/C(CO)=C\[C@H](OC)[C@]1([H])/C(C(=O)OC)=C\O[C@H]2OC3OC(CO)C(O)C(O)C3O | COC(=O)C1=CC2(CCN(C(=O)c3ccc(NC(=O)c4ccccc4F)cc3)c5ccccc5C2)CC1 |
|
|
|
|
|
|
| 00050040 81000000 00000801 90010101 80290041 00000801 00022880 28011402 01200000 015080e8 48000200 40419011 8402802a 02800000 02000405 012a9008 00820004 00000100 1145e010 00008a01 00100020 00001a90 0500a000 08100010 00201420 80201400 00405002 a4000020 00004240 00000000 1ea0a000 00000010 | 00014002 01001800 00100112 82110700 20080000 00002850 01000080 2a001402 11100800 081808c2 48380024 4001d000 0402884a 00b09000 00020440 0008000a 0286c200 02000000 08412018 04000201 40100100 18068e90 2101a000 2054001c 00201000 c0200400 00400010 90001081 04088302 00068003 a4060080 20010610 |