On Target AA2BR_HUMAN 0.22649573/CHEMBL3091705
For the given ligand yong1, we have found in our database that, being scored 0.22649573, the most similar ligand is CHEMBL3091705. Check out the elaboration below.
| yong1 (Given Ligand) | CHEMBL3091705 (Similar Ligand) |
|---|---|
| [H][C@@]12/C(CO)=C\[C@H](OC)[C@]1([H])/C(C(=O)OC)=C\O[C@H]2OC3OC(CO)C(O)C(O)C3O | CC(C)OC(=O)C1=C(C)NC(=S)NC1c2ccsc2 |
|
|
|
|
|
|
| 00050040 81000000 00000801 90010101 80290041 00000801 00022880 28011402 01200000 015080e8 48000200 40419011 8402802a 02800000 02000405 012a9008 00820004 00000100 1145e010 00008a01 00100020 00001a90 0500a000 08100010 00201420 80201400 00405002 a4000020 00004240 00000000 1ea0a000 00000010 | 00410000 00008008 00940908 81010f00 00100042 00c00070 06000005 20003400 01000c00 01990000 43300200 40009080 0c009008 40091001 00001001 00081008 20274001 02000100 30c7007c 0100ce81 00000120 58819a80 010081c0 40000190 8001fc02 84000000 00400000 a8040104 01200300 000e0202 04008040 c8c10a99 |