On Target ADRB2_HUMAN 0.25/CHEMBL1714856
For the given ligand yong1, we have found in our database that, being scored 0.25, the most similar ligand is CHEMBL1714856. Check out the elaboration below.
| yong1 (Given Ligand) | CHEMBL1714856 (Similar Ligand) |
|---|---|
| [H][C@@]12/C(CO)=C\[C@H](OC)[C@]1([H])/C(C(=O)OC)=C\O[C@H]2OC3OC(CO)C(O)C(O)C3O | COC(=O)C1=C(C[C@@H]2CC[C@H]1N2C(=O)NCc3cccc(F)c3)c4cccc(OCc5ccccc5)c4 |
|
|
|
|
|
|
| 00050040 81000000 00000801 90010101 80290041 00000801 00022880 28011402 01200000 015080e8 48000200 40419011 8402802a 02800000 02000405 012a9008 00820004 00000100 1145e010 00008a01 00100020 00001a90 0500a000 08100010 00201420 80201400 00405002 a4000020 00004240 00000000 1ea0a000 00000010 | 04010010 4b809208 2010030a 02010f00 00081040 40004810 82180184 3a003402 01800900 015828c8 49300000 51119000 0c82990a 20a11080 01000423 020c0108 20a24400 02000541 40c9a05a 00820201 80000100 18158eb0 010080a0 00d01018 01213083 80002401 00486000 d0010501 00400302 0006850b 6c0e0000 82002710 |