On Target CCR4_HUMAN 0.1878453/CHEMBL1621896
For the given ligand yong1, we have found in our database that, being scored 0.1878453, the most similar ligand is CHEMBL1621896. Check out the elaboration below.
| yong1 (Given Ligand) | CHEMBL1621896 (Similar Ligand) |
|---|---|
| [H][C@@]12/C(CO)=C\[C@H](OC)[C@]1([H])/C(C(=O)OC)=C\O[C@H]2OC3OC(CO)C(O)C(O)C3O | COc1ccc(Br)cc1CN2CCCC(C2)C(=O)N3CCCCC3 |
|
|
|
|
|
|
| 00050040 81000000 00000801 90010101 80290041 00000801 00022880 28011402 01200000 015080e8 48000200 40419011 8402802a 02800000 02000405 012a9008 00820004 00000100 1145e010 00008a01 00100020 00001a90 0500a000 08100010 00201420 80201400 00405002 a4000020 00004240 00000000 1ea0a000 00000010 | 00014000 21009408 20100108 00010600 00001000 00000100 02000000 22001400 40000000 001009e0 08200000 d0019000 0c008812 00000000 01000501 00002008 00000000 02000000 00000010 00020201 00000000 18048620 00008000 00500018 00001000 c0000000 00420000 90000000 00000300 00060011 24040008 08002200 |