On Target 5HT1D_HUMAN 0.20788531/CHEMBL151825
For the given ligand yong1, we have found in our database that, being scored 0.20788531, the most similar ligand is CHEMBL151825. Check out the elaboration below.
| yong1 (Given Ligand) | CHEMBL151825 (Similar Ligand) |
|---|---|
| [H][C@@]12/C(CO)=C\[C@H](OC)[C@]1([H])/C(C(=O)OC)=C\O[C@H]2OC3OC(CO)C(O)C(O)C3O | COC(=O)C1(CCN(CCCNC(=O)C2=C(C)N=C(C)\C(=C(\O)/OCCC#N)\C2c3ccc(cc3)[N+](=O)[O-])CC1)c4ccccc4 |
|
|
|
|
|
|
| 00050040 81000000 00000801 90010101 80290041 00000801 00022880 28011402 01200000 015080e8 48000200 40419011 8402802a 02800000 02000405 012a9008 00820004 00000100 1145e010 00008a01 00100020 00001a90 0500a000 08100010 00201420 80201400 00405002 a4000020 00004240 00000000 1ea0a000 00000010 | 00432002 01249e51 00304106 40210f01 02901051 04900000 10100809 30002440 15008800 20b909e1 0c330004 50019000 8503a00a 08210000 62140540 002c0c98 28424c04 42100302 04436008 08020a49 40020101 380a0f10 21008402 04504998 00420840 c0000001 40484240 b0040050 01004240 8006061b 04002000 c6882e80 |