On Target GASR_HUMAN 0.19026549/CHEMBL433028
For the given ligand yong1, we have found in our database that, being scored 0.19026549, the most similar ligand is CHEMBL433028. Check out the elaboration below.
| yong1 (Given Ligand) | CHEMBL433028 (Similar Ligand) |
|---|---|
| [H][C@@]12/C(CO)=C\[C@H](OC)[C@]1([H])/C(C(=O)OC)=C\O[C@H]2OC3OC(CO)C(O)C(O)C3O | CCOC(=O)CCCOc1ccc(NC(=O)NC2C(=O)N(CC34C[C@@H]5C[C@@H](C[C@@H](C5)C3)C4)c6ccccc6N(C2=O)c7ccccc7)cc1 |
|
|
|
|
|
|
| 00050040 81000000 00000801 90010101 80290041 00000801 00022880 28011402 01200000 015080e8 48000200 40419011 8402802a 02800000 02000405 012a9008 00820004 00000100 1145e010 00008a01 00100020 00001a90 0500a000 08100010 00201420 80201400 00405002 a4000020 00004240 00000000 1ea0a000 00000010 | 04054006 01003408 20100029 04010f00 20201000 02002000 02000014 20302009 00002100 00020be0 00282004 5001b000 0c80a022 00102000 11060041 00083008 00060010 10404100 1a402012 10020201 60100120 38050e10 21022001 0210001a 00101400 00000000 02040020 10008080 08008200 02060011 20025000 00006200 |