On Target OPRM_HUMAN 0.35826772/CHEMBL1330
For the given ligand yong1, we have found in our database that, being scored 0.35826772, the most similar ligand is CHEMBL1330. Check out the elaboration below.
| yong1 (Given Ligand) | CHEMBL1330 (Similar Ligand) |
|---|---|
| [H][C@@]12/C(CO)=C\[C@H](OC)[C@]1([H])/C(C(=O)OC)=C\O[C@H]2OC3OC(CO)C(O)C(O)C3O | CN1CC[C@]23[C@H]4Oc5c(O)ccc(C[C@@H]1[C@@H]2C=C[C@@H]4O[C@@H]6O[C@@H]([C@@H](O)[C@H](O)[C@H]6O)C(=O)O)c35 |
|
|
|
|
|
|
| 00050040 81000000 00000801 90010101 80290041 00000801 00022880 28011402 01200000 015080e8 48000200 40419011 8402802a 02800000 02000405 012a9008 00820004 00000100 1145e010 00008a01 00100020 00001a90 0500a000 08100010 00201420 80201400 00405002 a4000020 00004240 00000000 1ea0a000 00000010 | 04051040 cb000208 20100d0a 80b10700 80381161 c2800802 02083800 38000643 00202890 011818ea 48300300 5181d040 1c82c02a 23a00080 11240425 2a2eb018 08800200 a2008060 3549a012 0002a201 00100120 18200a10 0500e040 89540414 00201400 c0002401 04524200 b4800020 04000302 0007cc0a 24a20000 00012f50 |