On Target HRH2_HUMAN 0.16477273/CHEMBL1626
For the given ligand yong1, we have found in our database that, being scored 0.16477273, the most similar ligand is CHEMBL1626. Check out the elaboration below.
| yong1 (Given Ligand) | CHEMBL1626 (Similar Ligand) |
|---|---|
| [H][C@@]12/C(CO)=C\[C@H](OC)[C@]1([H])/C(C(=O)OC)=C\O[C@H]2OC3OC(CO)C(O)C(O)C3O | CN1CCC[C@@H]1CCO[C@](C)(c2ccccc2)c3ccc(Cl)cc3 |
|
|
|
|
|
|
| 00050040 81000000 00000801 90010101 80290041 00000801 00022880 28011402 01200000 015080e8 48000200 40419011 8402802a 02800000 02000405 012a9008 00820004 00000100 1145e010 00008a01 00100020 00001a90 0500a000 08100010 00201420 80201400 00405002 a4000020 00004240 00000000 1ea0a000 00000010 | 00008000 01000000 00100100 00010700 00080010 00004010 00000000 01000000 00000100 000808c0 08200000 40018800 020000a6 00890000 00000000 02081008 00a00000 02000000 00c02000 00000201 00000020 18000130 01000080 00500010 00002401 a0002000 000c0000 50000000 00000280 00060002 40000000 02022600 |