On Target NPSR1_HUMAN 0.1542056/CHEMBL1210411
For the given ligand yong1, we have found in our database that, being scored 0.1542056, the most similar ligand is CHEMBL1210411. Check out the elaboration below.
| yong1 (Given Ligand) | CHEMBL1210411 (Similar Ligand) |
|---|---|
| [H][C@@]12/C(CO)=C\[C@H](OC)[C@]1([H])/C(C(=O)OC)=C\O[C@H]2OC3OC(CO)C(O)C(O)C3O | CCC(CC)(CCN1CCOCC1)N(CC2=Cc3ccccc3N(C)C2=O)C(=O)C4CCCCC4 |
|
|
|
|
|
|
| 00050040 81000000 00000801 90010101 80290041 00000801 00022880 28011402 01200000 015080e8 48000200 40419011 8402802a 02800000 02000405 012a9008 00820004 00000100 1145e010 00008a01 00100020 00001a90 0500a000 08100010 00201420 80201400 00405002 a4000020 00004240 00000000 1ea0a000 00000010 | 10010002 0180d400 00104100 80010610 00041082 00004060 00004000 22001000 06000001 400009e0 05200004 40019000 0400980a 00600000 00181448 000c010c 10020000 82000004 02202000 00000201 c0000000 18088e18 32800000 80700018 00040400 c0000000 08800000 90000001 00400300 00060051 20060000 80002200 |