On Target CCR5_HUMAN 0.24774775/CHEMBL64322
For the given ligand yong1, we have found in our database that, being scored 0.24774775, the most similar ligand is CHEMBL64322. Check out the elaboration below.
| yong1 (Given Ligand) | CHEMBL64322 (Similar Ligand) |
|---|---|
| [H][C@@]12/C(CO)=C\[C@H](OC)[C@]1([H])/C(C(=O)OC)=C\O[C@H]2OC3OC(CO)C(O)C(O)C3O | [I-].Cc1ccc(cc1)c2ccc3CCCC(=Cc3c2)C(=O)Nc4ccc(C[N+](C)(C)C5CCOCC5)cc4 |
|
|
|
|
|
|
| 00050040 81000000 00000801 90010101 80290041 00000801 00022880 28011402 01200000 015080e8 48000200 40419011 8402802a 02800000 02000405 012a9008 00820004 00000100 1145e010 00008a01 00100020 00001a90 0500a000 08100010 00201420 80201400 00405002 a4000020 00004240 00000000 1ea0a000 00000010 | 10096202 01008800 00100302 80010700 a2080001 00002000 80000080 02001400 01800900 205808c0 08380004 60019808 0422880a 00398000 00020462 0008000a 20260400 02001100 0cc1a000 10800201 40100120 18008610 3108e0a0 00500010 01000401 c0002001 00406000 d00100c1 0040c302 00260003 24240000 00000600 |