On Target MC4R_HUMAN 0.21182266/CHEMBL398932
For the given ligand yong1, we have found in our database that, being scored 0.21182266, the most similar ligand is CHEMBL398932. Check out the elaboration below.
| yong1 (Given Ligand) | CHEMBL398932 (Similar Ligand) |
|---|---|
| [H][C@@]12/C(CO)=C\[C@H](OC)[C@]1([H])/C(C(=O)OC)=C\O[C@H]2OC3OC(CO)C(O)C(O)C3O | CN1CCN[C@H](C1)C(=O)N[C@@H](Cc2ccc(F)cc2)C(=O)N3CCC(CC3)(C4CCC(=O)C=C4)C(=O)NC(C)(C)C |
|
|
|
|
|
|
| 00050040 81000000 00000801 90010101 80290041 00000801 00022880 28011402 01200000 015080e8 48000200 40419011 8402802a 02800000 02000405 012a9008 00820004 00000100 1145e010 00008a01 00100020 00001a90 0500a000 08100010 00201420 80201400 00405002 a4000020 00004240 00000000 1ea0a000 00000010 | 00030000 01003600 00100100 06010600 00000000 00000010 00000080 2000040e 11200880 001889e0 08300000 5003b000 0e02800a 00003001 80000400 00040000 00004000 020000a0 00012018 02100201 00000100 38240690 00008023 83500018 00201800 80000000 00404000 90000001 0c000000 8006801b 24024000 00802600 |