On Target NK1R_HUMAN 0.27227724/CHEMBL420221
For the given ligand yong1, we have found in our database that, being scored 0.27227724, the most similar ligand is CHEMBL420221. Check out the elaboration below.
| yong1 (Given Ligand) | CHEMBL420221 (Similar Ligand) |
|---|---|
| [H][C@@]12/C(CO)=C\[C@H](OC)[C@]1([H])/C(C(=O)OC)=C\O[C@H]2OC3OC(CO)C(O)C(O)C3O | CC(=O)NCCCCCOC[C@H]1O[C@@H](OCCc2c[nH]c3ccccc23)[C@H](OCc4ccccc4)[C@@H](OCc5ccccc5)[C@@H]1OCc6ccccc6 |
|
|
|
|
|
|
| 00050040 81000000 00000801 90010101 80290041 00000801 00022880 28011402 01200000 015080e8 48000200 40419011 8402802a 02800000 02000405 012a9008 00820004 00000100 1145e010 00008a01 00100020 00001a90 0500a000 08100010 00201420 80201400 00405002 a4000020 00004240 00000000 1ea0a000 00000010 | 0000004a 01001800 80100100 40810710 802c1050 00004000 00002800 28000040 00602100 010828e0 08200004 40018000 00008802 03c10000 000c0040 022e900c 18800020 02000000 1560a400 00000201 40110020 18048628 25800000 88500018 00042400 80002000 08080000 34000020 00000200 00060003 40a40200 02000620 |