On Target OPRK_HUMAN 0.44666666/CHEMBL434746
For the given ligand yong1, we have found in our database that, being scored 0.44666666, the most similar ligand is CHEMBL434746. Check out the elaboration below.
| yong1 (Given Ligand) | CHEMBL434746 (Similar Ligand) |
|---|---|
| [H][C@@]12/C(CO)=C\[C@H](OC)[C@]1([H])/C(C(=O)OC)=C\O[C@H]2OC3OC(CO)C(O)C(O)C3O | CO[C@H]1O[C@@H](OC)C(=C1)[C@@H]2C[C@@]3(C)[C@@H](CC[C@@]4(C)[C@@H](C[C@H](OC(=O)C)C(=O)[C@H]34)C(=O)OC)C(=O)O2 |
|
|
|
|
|
|
| 00050040 81000000 00000801 90010101 80290041 00000801 00022880 28011402 01200000 015080e8 48000200 40419011 8402802a 02800000 02000405 012a9008 00820004 00000100 1145e010 00008a01 00100020 00001a90 0500a000 08100010 00201420 80201400 00405002 a4000020 00004240 00000000 1ea0a000 00000010 | 00050040 01000000 00000100 00810300 80380140 00800800 02000800 08000400 00200000 011200a0 40000000 4001d001 04028028 00800000 00000400 00281008 00820010 80000100 3340a010 00000001 00000020 10000a00 01008000 00100014 00001400 00001400 00404000 a4000000 00000200 0000000a 24a20000 02800010 |