On Target AA1R_HUMAN 0.2248996/CHEMBL608220
For the given ligand yong1, we have found in our database that, being scored 0.2248996, the most similar ligand is CHEMBL608220. Check out the elaboration below.
| yong1 (Given Ligand) | CHEMBL608220 (Similar Ligand) |
|---|---|
| [H][C@@]12/C(CO)=C\[C@H](OC)[C@]1([H])/C(C(=O)OC)=C\O[C@H]2OC3OC(CO)C(O)C(O)C3O | OC[C@H]1OC([C@H](O)[C@@H]1O)n2cnc3c(NC4CC5OC4C=C5)ncnc23 |
|
|
|
|
|
|
| 00050040 81000000 00000801 90010101 80290041 00000801 00022880 28011402 01200000 015080e8 48000200 40419011 8402802a 02800000 02000405 012a9008 00820004 00000100 1145e010 00008a01 00100020 00001a90 0500a000 08100010 00201420 80201400 00405002 a4000020 00004240 00000000 1ea0a000 00000010 | 0005000a 09c01820 82183100 88090620 203800e0 0000e010 02088c00 18100c02 10400100 019000b8 0c24800c 41039004 04021000 03880100 000a1489 101ec00c 00244030 00004060 19c02010 80201001 80180120 10040050 3780c0c4 0c000014 10001402 40108402 18400600 900000f0 04020208 00460400 c4281000 000002d0 |