On Target CXCR3_HUMAN 0.2173913/CHEMBL244814
For the given ligand yong1, we have found in our database that, being scored 0.2173913, the most similar ligand is CHEMBL244814. Check out the elaboration below.
| yong1 (Given Ligand) | CHEMBL244814 (Similar Ligand) |
|---|---|
| [H][C@@]12/C(CO)=C\[C@H](OC)[C@]1([H])/C(C(=O)OC)=C\O[C@H]2OC3OC(CO)C(O)C(O)C3O | CC1(C)[C@H]2CC=C(CN3CCC(CC3)NC(=O)Nc4cccc(OC5CCOCC5)c4)[C@@H]1C2 |
|
|
|
|
|
|
| 00050040 81000000 00000801 90010101 80290041 00000801 00022880 28011402 01200000 015080e8 48000200 40419011 8402802a 02800000 02000405 012a9008 00820004 00000100 1145e010 00008a01 00100020 00001a90 0500a000 08100010 00201420 80201400 00405002 a4000020 00004240 00000000 1ea0a000 00000010 | 04000016 81009408 20100008 00010f00 90081040 06000000 02100004 20002403 00000000 011009e0 00280004 50018000 00829102 08110010 01000441 00082108 20040100 00400120 09402000 00022601 40000120 18090410 2102a000 02100018 00310400 00000000 00484000 90000080 00008200 00060011 24120000 02026200 |