On Target NPY4R_HUMAN 0.17167382/CHEMBL2440912
For the given ligand yong1, we have found in our database that, being scored 0.17167382, the most similar ligand is CHEMBL2440912. Check out the elaboration below.
| yong1 (Given Ligand) | CHEMBL2440912 (Similar Ligand) |
|---|---|
| [H][C@@]12/C(CO)=C\[C@H](OC)[C@]1([H])/C(C(=O)OC)=C\O[C@H]2OC3OC(CO)C(O)C(O)C3O | NCCN(CCNC(=O)CCC(=O)NCCOCCOCCNC(=O)\N=C(\N)/NCCC[C@H](NC(=O)C(c1ccccc1)c2ccccc2)C(=O)NCc3ccc(CNC(=O)N)cc3)CCNC(=O)CCC(=O)NCCOCCOCCNC(=O)\N=C(\N)/NCCC[C@H](NC(=O)C(c4ccccc4)c5ccccc5)C(=O)NCc6ccc(CNC(=O)N)cc6.OC(=O)C(F)(F)F |
|
|
|
|
|
|
| 00050040 81000000 00000801 90010101 80290041 00000801 00022880 28011402 01200000 015080e8 48000200 40419011 8402802a 02800000 02000405 012a9008 00820004 00000100 1145e010 00008a01 00100020 00001a90 0500a000 08100010 00201420 80201400 00405002 a4000020 00004240 00000000 1ea0a000 00000010 | 00030040 01807000 00100100 84210e00 220000a0 00000000 00400000 23003048 00202380 001908c2 19200020 4003b000 87009812 00002008 c0081408 00190008 30000800 02000000 00000000 00000205 80102000 38258e20 16000003 8b500018 00000410 e0000000 40801000 d0000021 0c000392 000e0003 a40c6000 80802600 |