On Target PTAFR_HUMAN 0.43356642/CHEMBL371569
For the given ligand yong1, we have found in our database that, being scored 0.43356642, the most similar ligand is CHEMBL371569. Check out the elaboration below.
| yong1 (Given Ligand) | CHEMBL371569 (Similar Ligand) |
|---|---|
| [H][C@@]12/C(CO)=C\[C@H](OC)[C@]1([H])/C(C(=O)OC)=C\O[C@H]2OC3OC(CO)C(O)C(O)C3O | C[C@@H]1CCC2=C3CO[C@]2(O)[C@H]4O[C@]4(C)CC\C=C(/C)\CC[C@]13C |
|
|
|
|
|
|
| 00050040 81000000 00000801 90010101 80290041 00000801 00022880 28011402 01200000 015080e8 48000200 40419011 8402802a 02800000 02000405 012a9008 00820004 00000100 1145e010 00008a01 00100020 00001a90 0500a000 08100010 00201420 80201400 00405002 a4000020 00004240 00000000 1ea0a000 00000010 | 00040040 81000000 00000800 80810100 000801c0 00000800 02000800 28000442 00002000 01100028 40000200 40008000 08020000 00800000 00000404 00289008 00800010 00000020 21402010 0000a001 00000020 00001000 0500a000 08000010 00201400 00001400 00404200 a0000020 00000200 00000000 24220000 00000010 |