On Target 5HT1F_HUMAN 0.14634146/CHEMBL187928
For the given ligand yong1, we have found in our database that, being scored 0.14634146, the most similar ligand is CHEMBL187928. Check out the elaboration below.
| yong1 (Given Ligand) | CHEMBL187928 (Similar Ligand) |
|---|---|
| [H][C@@]12/C(CO)=C\[C@H](OC)[C@]1([H])/C(C(=O)OC)=C\O[C@H]2OC3OC(CO)C(O)C(O)C3O | OC(=O)C(F)(F)F.O=C(\C=C\c1ccccc1)N(Cc2ccc(cc2)c3ccc(CNCCc4ccccc4)cc3)Cc5cccnc5 |
|
|
|
|
|
|
| 00050040 81000000 00000801 90010101 80290041 00000801 00022880 28011402 01200000 015080e8 48000200 40419011 8402802a 02800000 02000405 012a9008 00820004 00000100 1145e010 00008a01 00100020 00001a90 0500a000 08100010 00201420 80201400 00405002 a4000020 00004240 00000000 1ea0a000 00000010 | 10002002 01808000 00104100 00010610 00041000 00000000 80104080 02001400 01800180 00480840 09200004 40008000 80008802 00010000 00000402 000c000c 20022400 02000104 04218000 10800204 c0000000 18208e00 30800000 81400018 00040000 c0000000 08482200 d0010040 04404100 00060003 24040000 80000600 |