On Target GRM5_HUMAN 0.20304568/CHEMBL3086720
For the given ligand yong1, we have found in our database that, being scored 0.20304568, the most similar ligand is CHEMBL3086720. Check out the elaboration below.
| yong1 (Given Ligand) | CHEMBL3086720 (Similar Ligand) |
|---|---|
| [H][C@@]12/C(CO)=C\[C@H](OC)[C@]1([H])/C(C(=O)OC)=C\O[C@H]2OC3OC(CO)C(O)C(O)C3O | COC(=O)N1CCC2(CC1)CC(O)(CO2)C#Cc3cccc(C)c3 |
|
|
|
|
|
|
| 00050040 81000000 00000801 90010101 80290041 00000801 00022880 28011402 01200000 015080e8 48000200 40419011 8402802a 02800000 02000405 012a9008 00820004 00000100 1145e010 00008a01 00100020 00001a90 0500a000 08100010 00201420 80201400 00405002 a4000020 00004240 00000000 1ea0a000 00000010 | 00000240 01025000 00100902 00090700 00482001 00008000 00200000 20000000 00000200 010008c0 00240080 5001c008 00008082 01881000 00080000 001b9008 00220200 82080000 01c02000 00000201 00000028 19940d50 05000881 0a500019 00000405 8004000a 00000000 10000020 00000208 00064201 80000804 00000200 |