On Target CLTR1_HUMAN 0.2244898/CHEMBL285954
For the given ligand yong1, we have found in our database that, being scored 0.2244898, the most similar ligand is CHEMBL285954. Check out the elaboration below.
| yong1 (Given Ligand) | CHEMBL285954 (Similar Ligand) |
|---|---|
| [H][C@@]12/C(CO)=C\[C@H](OC)[C@]1([H])/C(C(=O)OC)=C\O[C@H]2OC3OC(CO)C(O)C(O)C3O | CCCCC\C=C/C\C=C/C=C/C=C/[C@@H](Sc1ccc(cc1)C(=O)O)[C@@H](O)CCCC(=O)O |
|
|
|
|
|
|
| 00050040 81000000 00000801 90010101 80290041 00000801 00022880 28011402 01200000 015080e8 48000200 40419011 8402802a 02800000 02000405 012a9008 00820004 00000100 1145e010 00008a01 00100020 00001a90 0500a000 08100010 00201420 80201400 00405002 a4000020 00004240 00000000 1ea0a000 00000010 | 00010402 01841a00 00020100 00110200 40180000 00004001 00000000 00000402 04208100 00104840 00401220 60029000 04138028 02850000 02010404 0008000c 04800000 02000001 00406080 00220001 80002001 0a120a20 01808100 0060081f 00202010 80000000 00404000 80000010 00000000 40120000 f4820000 05010020 |