On Target AGTR2_HUMAN 0.19532908/CHEMBL507053
For the given ligand yong1, we have found in our database that, being scored 0.19532908, the most similar ligand is CHEMBL507053. Check out the elaboration below.
| yong1 (Given Ligand) | CHEMBL507053 (Similar Ligand) |
|---|---|
| [H][C@@]12/C(CO)=C\[C@H](OC)[C@]1([H])/C(C(=O)OC)=C\O[C@H]2OC3OC(CO)C(O)C(O)C3O | CO\C(=C/1\NC(=O)[C@@H](NC(=O)c2csc(n2)c3cc(O)c(nc3c4csc(n4)[C@@H]5COC(=O)c6c7CO[C@@H]([C@H](NC(=O)c8csc1n8)c9nc(cs9)C(=O)N5)[C@H](O[C@H]%10C[C@](C)(O)[C@@H]([C@H](C)O%10)N(C)C)C(=O)OCc%11cccc(c7%11)n6O)c%12nc(cs%12)C(=O)NCCNC(=O)CN(C)C)[C@@H](C)O)\C |
|
|
|
|
|
|
| 00050040 81000000 00000801 90010101 80290041 00000801 00022880 28011402 01200000 015080e8 48000200 40419011 8402802a 02800000 02000405 012a9008 00820004 00000100 1145e010 00008a01 00100020 00001a90 0500a000 08100010 00201420 80201400 00405002 a4000020 00004240 00000000 1ea0a000 00000010 | 0047865a 41037809 e6305b44 f48d1f31 b01d50f3 0430c006 c3d03aa2 383bfddf 10622780 1945ccf3 802f9a65 f001fe38 9f0298f6 02f9a063 c2023449 0a3cb95c 10a69841 96a034a6 05e1a018 7242aae5 4090b820 f9179ffb b790708a 8ec5013c 9694b403 ae11a911 68fa0278 b45417e5 0c59c21f 07e61401 ecf45a8c b6810a31 |