On Target NPY5R_HUMAN 0.26/CHEMBL508770
For the given ligand yong1, we have found in our database that, being scored 0.26, the most similar ligand is CHEMBL508770. Check out the elaboration below.
| yong1 (Given Ligand) | CHEMBL508770 (Similar Ligand) |
|---|---|
| [H][C@@]12/C(CO)=C\[C@H](OC)[C@]1([H])/C(C(=O)OC)=C\O[C@H]2OC3OC(CO)C(O)C(O)C3O | CC1(C)CC(=C([C@H]2C3=C(CC(C)(C)CC3=O)Oc4ccccc24)C(=O)C1)O |
|
|
|
|
|
|
| 00050040 81000000 00000801 90010101 80290041 00000801 00022880 28011402 01200000 015080e8 48000200 40419011 8402802a 02800000 02000405 012a9008 00820004 00000100 1145e010 00008a01 00100020 00001a90 0500a000 08100010 00201420 80201400 00405002 a4000020 00004240 00000000 1ea0a000 00000010 | 04010002 01000008 2000010a 0001030a 00081800 82800000 06000081 00000602 01040808 009a8840 08900000 40009040 8482802a 00a00000 13000401 00083408 00800600 22108020 00652008 0a020801 00000101 18000288 01008000 0c480c10 00600800 c0000000 00405040 80000000 00004302 80024002 24060000 00000400 |