On Target DRD5_HUMAN 0.16170213/CHEMBL1258223
For the given ligand yong1, we have found in our database that, being scored 0.16170213, the most similar ligand is CHEMBL1258223. Check out the elaboration below.
| yong1 (Given Ligand) | CHEMBL1258223 (Similar Ligand) |
|---|---|
| [H][C@@]12/C(CO)=C\[C@H](OC)[C@]1([H])/C(C(=O)OC)=C\O[C@H]2OC3OC(CO)C(O)C(O)C3O | CCCCN1CCC(COC(=O)c2cc(Cl)c(NC)c3OCCOc23)CC1 |
|
|
|
|
|
|
| 00050040 81000000 00000801 90010101 80290041 00000801 00022880 28011402 01200000 015080e8 48000200 40419011 8402802a 02800000 02000405 012a9008 00820004 00000100 1145e010 00008a01 00100020 00001a90 0500a000 08100010 00201420 80201400 00405002 a4000020 00004240 00000000 1ea0a000 00000010 | 04008002 d9000808 20100108 80290700 80101010 04024000 96000200 28000800 00002130 000008c8 00240004 50018820 0280c006 08018082 81204047 2208f008 00060800 02008400 08480002 00022601 40000020 38020b20 25400000 08500014 00002400 80002400 20180a00 10800080 00808300 0006080a c0004000 02022a00 |