On Target NPFF1_HUMAN 0.15476191/CHEMBL3746851
For the given ligand yong1, we have found in our database that, being scored 0.15476191, the most similar ligand is CHEMBL3746851. Check out the elaboration below.
| yong1 (Given Ligand) | CHEMBL3746851 (Similar Ligand) |
|---|---|
| [H][C@@]12/C(CO)=C\[C@H](OC)[C@]1([H])/C(C(=O)OC)=C\O[C@H]2OC3OC(CO)C(O)C(O)C3O | Cn1cc(CNC(=O)\N=C(\N)/NCCC[C@@H](NC(=O)C(c2ccccc2)c3ccccc3)C(=O)NCc4ccc(O)cc4)nn1.OC(=O)C(F)(F)F |
|
|
|
|
|
|
| 00050040 81000000 00000801 90010101 80290041 00000801 00022880 28011402 01200000 015080e8 48000200 40419011 8402802a 02800000 02000405 012a9008 00820004 00000100 1145e010 00008a01 00100020 00001a90 0500a000 08100010 00201420 80201400 00405002 a4000020 00004240 00000000 1ea0a000 00000010 | 00010040 45803018 60500102 84010e10 22002020 00000000 02404000 23007408 00200280 103908c2 18210020 4023b800 07009896 04002008 c0011400 001c200c 00040800 82000000 00400000 00061205 80122000 38258e20 01001001 83540018 00200010 e0000000 40221000 d0002000 0c000194 00060103 b40c6000 84002602 |