On Target 5HT1B_HUMAN 0.1921824/CHEMBL442
For the given ligand yong1, we have found in our database that, being scored 0.1921824, the most similar ligand is CHEMBL442. Check out the elaboration below.
| yong1 (Given Ligand) | CHEMBL442 (Similar Ligand) |
|---|---|
| [H][C@@]12/C(CO)=C\[C@H](OC)[C@]1([H])/C(C(=O)OC)=C\O[C@H]2OC3OC(CO)C(O)C(O)C3O | CN1C[C@@H](C=C2[C@H]1Cc3c[nH]c4cccc2c34)C(=O)N[C@]5(C)O[C@@]6(O)[C@@H]7CCCN7C(=O)[C@H](Cc8ccccc8)N6C5=O |
|
|
|
|
|
|
| 00050040 81000000 00000801 90010101 80290041 00000801 00022880 28011402 01200000 015080e8 48000200 40419011 8402802a 02800000 02000405 012a9008 00820004 00000100 1145e010 00008a01 00100020 00001a90 0500a000 08100010 00201420 80201400 00405002 a4000020 00004240 00000000 1ea0a000 00000010 | 02000012 29d0fe00 01900302 c5910710 000c1180 00038010 800a30c0 a000040e 00c00ac0 001909ea 08302004 4101f000 be02890e 01612b03 8018104a 183e120c 30800440 82080144 00660d1a 00000201 40000520 3a2486b8 33808023 9350003c 31243c00 80081002 18c82048 f0200021 0c404200 00260c1b a4044200 02012620 |