On Target NPY1R_HUMAN 0.2792793/CHEMBL1223998
For the given ligand yong1, we have found in our database that, being scored 0.2792793, the most similar ligand is CHEMBL1223998. Check out the elaboration below.
| yong1 (Given Ligand) | CHEMBL1223998 (Similar Ligand) |
|---|---|
| [H][C@@]12/C(CO)=C\[C@H](OC)[C@]1([H])/C(C(=O)OC)=C\O[C@H]2OC3OC(CO)C(O)C(O)C3O | O[C@@H]1O[C@H](COC(=O)CCC(=O)NC(=N)NCCC[C@@H](NC(=O)C(c2ccccc2)c3ccccc3)C(=O)NCc4ccc(O)cc4)[C@H](O)[C@H](O)[C@H]1O |
|
|
|
|
|
|
| 00050040 81000000 00000801 90010101 80290041 00000801 00022880 28011402 01200000 015080e8 48000200 40419011 8402802a 02800000 02000405 012a9008 00820004 00000100 1145e010 00008a01 00100020 00001a90 0500a000 08100010 00201420 80201400 00405002 a4000020 00004240 00000000 1ea0a000 00000010 | 00070040 01803008 20100508 04810f00 80380040 00000000 02002804 23003048 00202280 010908e2 08200000 4003b000 07009812 02802000 c0000400 003a9008 00820000 02000100 11402040 00020201 80010120 38258e20 05000001 8b500018 00010400 e0000000 40220200 f0000020 0c000392 0006000b a0ac6000 00802e00 |