On Target OPRD_HUMAN 0.3256705/CHEMBL1743605
For the given ligand yong1, we have found in our database that, being scored 0.3256705, the most similar ligand is CHEMBL1743605. Check out the elaboration below.
| yong1 (Given Ligand) | CHEMBL1743605 (Similar Ligand) |
|---|---|
| [H][C@@]12/C(CO)=C\[C@H](OC)[C@]1([H])/C(C(=O)OC)=C\O[C@H]2OC3OC(CO)C(O)C(O)C3O | CN(C)[C@@H](Cc1c(C)cc(O)cc1C)C(=O)N2Cc3ccccc3C[C@H]2C(=O)NCCC(=O)OC4=C5O[C@H]6[C@@H](O)C=C[C@H]7[C@H]8CC(C=C4)C5[C@@]67CCN8C.OC(=O)C(F)(F)F.OC(=O)C(F)(F)F |
|
|
|
|
|
|
| 00050040 81000000 00000801 90010101 80290041 00000801 00022880 28011402 01200000 015080e8 48000200 40419011 8402802a 02800000 02000405 012a9008 00820004 00000100 1145e010 00008a01 00100020 00001a90 0500a000 08100010 00201420 80201400 00405002 a4000020 00004240 00000000 1ea0a000 00000010 | 00248048 c9843608 20100900 94010701 40582021 00000801 03080000 3a00140e 10000889 405908c8 c8300200 5141f210 8e028882 03a82001 82080484 030d900c 00a24204 02000061 22c16098 0022a205 80020120 38309e30 0500e083 8b50001a 04221c01 c0000401 00524200 90000020 0c014340 0086041b 24064800 00802e10 |