On Target CNR2_HUMAN 0.31617647/CHEMBL122972
For the given ligand yong1, we have found in our database that, being scored 0.31617647, the most similar ligand is CHEMBL122972. Check out the elaboration below.
| yong1 (Given Ligand) | CHEMBL122972 (Similar Ligand) |
|---|---|
| [H][C@@]12/C(CO)=C\[C@H](OC)[C@]1([H])/C(C(=O)OC)=C\O[C@H]2OC3OC(CO)C(O)C(O)C3O | CCCCC\C=C/C\C=C/C\C=C/C\C=C/CCCC(=O)OC(CO)CO |
|
|
|
|
|
|
| 00050040 81000000 00000801 90010101 80290041 00000801 00022880 28011402 01200000 015080e8 48000200 40419011 8402802a 02800000 02000405 012a9008 00820004 00000100 1145e010 00008a01 00100020 00001a90 0500a000 08100010 00201420 80201400 00405002 a4000020 00004240 00000000 1ea0a000 00000010 | 00010002 01000000 00000400 00010300 00080000 00000000 00000000 00000402 00000000 00108008 00000000 40009000 04028000 00000000 00000400 00089008 00820000 00000000 01402000 00020001 00000021 00000a00 05008000 08000810 00200400 00000000 00404000 80000020 00000200 00000000 24000000 00000000 |