On Target CCKAR_HUMAN 0.15686275/CHEMBL332263
For the given ligand yong1, we have found in our database that, being scored 0.15686275, the most similar ligand is CHEMBL332263. Check out the elaboration below.
| yong1 (Given Ligand) | CHEMBL332263 (Similar Ligand) |
|---|---|
| [H][C@@]12/C(CO)=C\[C@H](OC)[C@]1([H])/C(C(=O)OC)=C\O[C@H]2OC3OC(CO)C(O)C(O)C3O | Cc1ccccc1NC(=O)NCCCC[C@@H](CNC(=O)CCC(=O)O)NC(=O)[C@@](C)(Cc2c[nH]c3ccccc23)NC(=O)OC4C5CC6CC(CC4C6)C5 |
|
|
|
|
|
|
| 00050040 81000000 00000801 90010101 80290041 00000801 00022880 28011402 01200000 015080e8 48000200 40419011 8402802a 02800000 02000405 012a9008 00820004 00000100 1145e010 00008a01 00100020 00001a90 0500a000 08100010 00201420 80201400 00405002 a4000020 00004240 00000000 1ea0a000 00000010 | 00060006 01403a00 00100100 45810f10 001c1200 00018002 00002004 a000200d 00c00a00 000908c0 08380004 4001b000 1c009802 00d02900 00020040 001e000c 00860000 02480020 0a602c18 00000201 40000100 38258e38 21822003 93500018 00153800 80001002 08000010 102010a0 0c008202 0006000b a00e4200 00806e20 |